C17H24 — CID 175560244
8,9,10-trimethylidene-2,3,4,4a,5,6,7,8a,9a,10a-decahydro-1H-anthracene (PubChem CID 175560244) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 8,9,10-trimethylidene-2,3,4,4a,5,6,7,8a,9a,10a-decahydro-1H-anthracene.
| Compound Name | 8,9,10-trimethylidene-2,3,4,4a,5,6,7,8a,9a,10a-decahydro-1H-anthracene |
|---|---|
| PubChem CID | 175560244 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 8,9,10-trimethylidene-2,3,4,4a,5,6,7,8a,9a,10a-decahydro-1H-anthracene |
| SMILES | C=C1C2CCCCC2C(=C)C2C(=C)CCCC12 |
| InChI | InChI=1S/C17H24/c1-11-7-6-10-16-12(2)14-8-4-5-9-15(14)13(3)17(11)16/h14-17H,1-10H2 |
| InChIKey | DRSLIVKQZJMHTH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|