About ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol
ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol (PubChem CID 157029785) has the molecular formula C17H38O2
and a molecular weight of 274.49 g/mol. Its IUPAC name is ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol.
Molecular Properties
| Compound Name | ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol |
| PubChem CID | 157029785 |
| Molecular Formula | C17H38O2 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.29 |
| IUPAC Name | ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol |
| SMILES | CC.CC.CC1CCCC1O.CC1CCCCC1O |
| InChI | InChI=1S/C7H14O.C6H12O.2C2H6/c1-6-4-2-3-5-7(6)8;1-5-3-2-4-6(5)7;2*1-2/h6-8H,2-5H2,1H3;5-7H,2-4H2,1H3;2*1-2H3 |
| InChIKey | YSEBGSPDGHTENS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol?
The IUPAC name of ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol (CID 157029785) is ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol.
What is the SMILES notation for ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol?
The canonical SMILES for ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol is CC.CC.CC1CCCC1O.CC1CCCCC1O.
What is the InChIKey of ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol?
The InChIKey is YSEBGSPDGHTENS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C6H12O.2C2H6/c1-6-4-2-3-5-7(6)8;1-5-3-2-4-6(5)7;2*1-2/h6-8H,2-5H2,1H3;5-7H,2-4H2,1H3;2*1-2H3.
What are the key properties of ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol?
ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol has a molecular weight of 274.49 g/mol, XLogP of 4.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylcyclohexan-1-ol;2-methylcyclopentan-1-ol is sourced from PubChem (CID 157029785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).