acetic acid;2-methylcyclopentan-1-ol

C8H16O3 — CID 71356720

IUPACacetic acid;2-methylcyclopentan-1-ol
SMILESCC(=O)O.CC1CCCC1O
InChIInChI=1S/C6H12O.C2H4O2/c1-5-3-2-4-6(5)7;1-2(3)4/h5-7H,2-4H2,1H3;1H3,(H,3,4)
InChIKeyRSWSXJPQDQFRIU-UHFFFAOYSA-N
MW160.21 g/mol
LogP1.26
Rot. Bonds

About acetic acid;2-methylcyclopentan-1-ol

acetic acid;2-methylcyclopentan-1-ol (PubChem CID 71356720) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is acetic acid;2-methylcyclopentan-1-ol.

Molecular Properties

Compound Nameacetic acid;2-methylcyclopentan-1-ol
PubChem CID71356720
Molecular FormulaC8H16O3
Molecular Weight160.21 g/mol
Exact Mass160.11
IUPAC Nameacetic acid;2-methylcyclopentan-1-ol
SMILESCC(=O)O.CC1CCCC1O
InChIInChI=1S/C6H12O.C2H4O2/c1-5-3-2-4-6(5)7;1-2(3)4/h5-7H,2-4H2,1H3;1H3,(H,3,4)
InChIKeyRSWSXJPQDQFRIU-UHFFFAOYSA-N
XLogP1.26
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.21
LogP ≤ 51.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze acetic acid;2-methylcyclopentan-1-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-methylcyclopentan-1-ol?
The IUPAC name of acetic acid;2-methylcyclopentan-1-ol (CID 71356720) is acetic acid;2-methylcyclopentan-1-ol.
What is the SMILES notation for acetic acid;2-methylcyclopentan-1-ol?
The canonical SMILES for acetic acid;2-methylcyclopentan-1-ol is CC(=O)O.CC1CCCC1O.
What is the InChIKey of acetic acid;2-methylcyclopentan-1-ol?
The InChIKey is RSWSXJPQDQFRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C2H4O2/c1-5-3-2-4-6(5)7;1-2(3)4/h5-7H,2-4H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-methylcyclopentan-1-ol?
acetic acid;2-methylcyclopentan-1-ol has a molecular weight of 160.21 g/mol, XLogP of 1.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-methylcyclopentan-1-ol is sourced from PubChem (CID 71356720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).