2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid

C10H16O4 — CID 139926893

IUPAC2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid
SMILESC[C@H]1CCC[C@@H]1C(C)(C(=O)O)C(=O)O
InChIInChI=1S/C10H16O4/c1-6-4-3-5-7(6)10(2,8(11)12)9(13)14/h6-7H,3-5H2,1-2H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1
InChIKeyVNEXDJAEJMZOFT-BQBZGAKWSA-N
MW200.23 g/mol
LogP1.60
Rot. Bonds3

About 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid

2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid (PubChem CID 139926893) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid.

Molecular Properties

Compound Name2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid
PubChem CID139926893
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid
SMILESC[C@H]1CCC[C@@H]1C(C)(C(=O)O)C(=O)O
InChIInChI=1S/C10H16O4/c1-6-4-3-5-7(6)10(2,8(11)12)9(13)14/h6-7H,3-5H2,1-2H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1
InChIKeyVNEXDJAEJMZOFT-BQBZGAKWSA-N
XLogP1.60
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid?
The IUPAC name of 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid (CID 139926893) is 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid.
What is the SMILES notation for 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid?
The canonical SMILES for 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid is C[C@H]1CCC[C@@H]1C(C)(C(=O)O)C(=O)O.
What is the InChIKey of 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid?
The InChIKey is VNEXDJAEJMZOFT-BQBZGAKWSA-N. The full InChI is InChI=1S/C10H16O4/c1-6-4-3-5-7(6)10(2,8(11)12)9(13)14/h6-7H,3-5H2,1-2H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1.
What are the key properties of 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid?
2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid has a molecular weight of 200.23 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid is sourced from PubChem (CID 139926893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).