C10H16O4 — CID 139926893
2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid (PubChem CID 139926893) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid.
| Compound Name | 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid |
|---|---|
| PubChem CID | 139926893 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-methyl-2-[(1S,2S)-2-methylcyclopentyl]propanedioic acid |
| SMILES | C[C@H]1CCC[C@@H]1C(C)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16O4/c1-6-4-3-5-7(6)10(2,8(11)12)9(13)14/h6-7H,3-5H2,1-2H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | VNEXDJAEJMZOFT-BQBZGAKWSA-N |
| XLogP | 1.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|