C13H26O2 — CID 155621775
2-[(1R)-2-(2-hydroxypropan-2-yl)-3-methylcyclohexyl]propan-2-ol (PubChem CID 155621775) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-[(1R)-2-(2-hydroxypropan-2-yl)-3-methylcyclohexyl]propan-2-ol.
| Compound Name | 2-[(1R)-2-(2-hydroxypropan-2-yl)-3-methylcyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 155621775 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2-[(1R)-2-(2-hydroxypropan-2-yl)-3-methylcyclohexyl]propan-2-ol |
| SMILES | CC1CCC[C@@H](C(C)(C)O)C1C(C)(C)O |
| InChI | InChI=1S/C13H26O2/c1-9-7-6-8-10(12(2,3)14)11(9)13(4,5)15/h9-11,14-15H,6-8H2,1-5H3/t9?,10-,11?/m1/s1 |
| InChIKey | GAZZJRBKZBQPDE-HSOILSAZSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |