C9H20O — CID 143642035
ethane;trans-(1S,2S)-2-methylcyclohexan-1-ol (PubChem CID 143642035) has the molecular formula C9H20O and a molecular weight of 144.26 g/mol. Its IUPAC name is ethane;trans-(1S,2S)-2-methylcyclohexan-1-ol.
| Compound Name | ethane;trans-(1S,2S)-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 143642035 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | ethane;trans-(1S,2S)-2-methylcyclohexan-1-ol |
| SMILES | CC.C[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C7H14O.C2H6/c1-6-4-2-3-5-7(6)8;1-2/h6-8H,2-5H2,1H3;1-2H3/t6-,7-;/m0./s1 |
| InChIKey | QUGWMIGXVABLDY-LEUCUCNGSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |