About cyclohexane-1,2-diol;ethane;propane
cyclohexane-1,2-diol;ethane;propane (PubChem CID 143149782) has the molecular formula C14H34O2
and a molecular weight of 234.42 g/mol. Its IUPAC name is cyclohexane-1,2-diol;ethane;propane.
Molecular Properties
| Compound Name | cyclohexane-1,2-diol;ethane;propane |
| PubChem CID | 143149782 |
| Molecular Formula | C14H34O2 |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.26 |
| IUPAC Name | cyclohexane-1,2-diol;ethane;propane |
| SMILES | CC.CCC.CCC.OC1CCCCC1O |
| InChI | InChI=1S/C6H12O2.2C3H8.C2H6/c7-5-3-1-2-4-6(5)8;2*1-3-2;1-2/h5-8H,1-4H2;2*3H2,1-2H3;1-2H3 |
| InChIKey | MDUZFCMKUPJBCR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexane-1,2-diol;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,2-diol;ethane;propane?
The IUPAC name of cyclohexane-1,2-diol;ethane;propane (CID 143149782) is cyclohexane-1,2-diol;ethane;propane.
What is the SMILES notation for cyclohexane-1,2-diol;ethane;propane?
The canonical SMILES for cyclohexane-1,2-diol;ethane;propane is CC.CCC.CCC.OC1CCCCC1O.
What is the InChIKey of cyclohexane-1,2-diol;ethane;propane?
The InChIKey is MDUZFCMKUPJBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.2C3H8.C2H6/c7-5-3-1-2-4-6(5)8;2*1-3-2;1-2/h5-8H,1-4H2;2*3H2,1-2H3;1-2H3.
What are the key properties of cyclohexane-1,2-diol;ethane;propane?
cyclohexane-1,2-diol;ethane;propane has a molecular weight of 234.42 g/mol, XLogP of 4.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,2-diol;ethane;propane is sourced from PubChem (CID 143149782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).