C14H34O2 — CID 143149782
cyclohexane-1,2-diol;ethane;propane (PubChem CID 143149782) has the molecular formula C14H34O2 and a molecular weight of 234.42 g/mol. Its IUPAC name is cyclohexane-1,2-diol;ethane;propane.
| Compound Name | cyclohexane-1,2-diol;ethane;propane |
|---|---|
| PubChem CID | 143149782 |
| Molecular Formula | C14H34O2 |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.26 |
| IUPAC Name | cyclohexane-1,2-diol;ethane;propane |
| SMILES | CC.CCC.CCC.OC1CCCCC1O |
| InChI | InChI=1S/C6H12O2.2C3H8.C2H6/c7-5-3-1-2-4-6(5)8;2*1-3-2;1-2/h5-8H,1-4H2;2*3H2,1-2H3;1-2H3 |
| InChIKey | MDUZFCMKUPJBCR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |