C9H14F6O6S2 — CID 91351531
trans-(1R,2R)-2-methylcyclohexan-1-ol;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 91351531) has the molecular formula C9H14F6O6S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is trans-(1R,2R)-2-methylcyclohexan-1-ol;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | trans-(1R,2R)-2-methylcyclohexan-1-ol;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91351531 |
| Molecular Formula | C9H14F6O6S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | trans-(1R,2R)-2-methylcyclohexan-1-ol;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | C[C@@H]1CCCC[C@H]1O.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H14O.C2F6O5S2/c1-6-4-2-3-5-7(6)8;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h6-8H,2-5H2,1H3;/t6-,7-;/m1./s1 |
| InChIKey | NFUALKQWTBCRGA-ZJLYAJKPSA-N |
| XLogP | 2.26 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|