About (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate
(methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 23649989) has the molecular formula C4H6F6O5S4
and a molecular weight of 376.34 g/mol. Its IUPAC name is (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate |
| PubChem CID | 23649989 |
| Molecular Formula | C4H6F6O5S4 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.90 |
| IUPAC Name | (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CSSC.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C2F6O5S2.C2H6S2/c3-1(4,5)14(9,10)13-15(11,12)2(6,7)8;1-3-4-2/h;1-2H3 |
| InChIKey | BDNSYKYMRTZMPU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate?
The IUPAC name of (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate (CID 23649989) is (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate.
What is the SMILES notation for (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate?
The canonical SMILES for (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate is CSSC.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate?
The InChIKey is BDNSYKYMRTZMPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F6O5S2.C2H6S2/c3-1(4,5)14(9,10)13-15(11,12)2(6,7)8;1-3-4-2/h;1-2H3.
What are the key properties of (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate?
(methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate has a molecular weight of 376.34 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (methyldisulfanyl)methane;trifluoromethylsulfonyl trifluoromethanesulfonate is sourced from PubChem (CID 23649989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).