About pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate
pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 159747202) has the molecular formula C7H10F6O7S2
and a molecular weight of 384.27 g/mol. Its IUPAC name is pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate |
| PubChem CID | 159747202 |
| Molecular Formula | C7H10F6O7S2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CCCCC(=O)O.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H10O2.C2F6O5S2/c1-2-3-4-5(6)7;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h2-4H2,1H3,(H,6,7); |
| InChIKey | NDEOBCKIGMTGPI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate?
The IUPAC name of pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate (CID 159747202) is pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate.
What is the SMILES notation for pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate?
The canonical SMILES for pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate is CCCCC(=O)O.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate?
The InChIKey is NDEOBCKIGMTGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C2F6O5S2/c1-2-3-4-5(6)7;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h2-4H2,1H3,(H,6,7);.
What are the key properties of pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate?
pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate has a molecular weight of 384.27 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoic acid;trifluoromethylsulfonyl trifluoromethanesulfonate is sourced from PubChem (CID 159747202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).