About pentanoic acid;trifluoromethanesulfonic acid
pentanoic acid;trifluoromethanesulfonic acid (PubChem CID 158887018) has the molecular formula C6H11F3O5S
and a molecular weight of 252.21 g/mol. Its IUPAC name is pentanoic acid;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | pentanoic acid;trifluoromethanesulfonic acid |
| PubChem CID | 158887018 |
| Molecular Formula | C6H11F3O5S |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | pentanoic acid;trifluoromethanesulfonic acid |
| SMILES | CCCCC(=O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C5H10O2.CHF3O3S/c1-2-3-4-5(6)7;2-1(3,4)8(5,6)7/h2-4H2,1H3,(H,6,7);(H,5,6,7) |
| InChIKey | JDTHLZIQQADNLI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze pentanoic acid;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanoic acid;trifluoromethanesulfonic acid?
The IUPAC name of pentanoic acid;trifluoromethanesulfonic acid (CID 158887018) is pentanoic acid;trifluoromethanesulfonic acid.
What is the SMILES notation for pentanoic acid;trifluoromethanesulfonic acid?
The canonical SMILES for pentanoic acid;trifluoromethanesulfonic acid is CCCCC(=O)O.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of pentanoic acid;trifluoromethanesulfonic acid?
The InChIKey is JDTHLZIQQADNLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.CHF3O3S/c1-2-3-4-5(6)7;2-1(3,4)8(5,6)7/h2-4H2,1H3,(H,6,7);(H,5,6,7).
What are the key properties of pentanoic acid;trifluoromethanesulfonic acid?
pentanoic acid;trifluoromethanesulfonic acid has a molecular weight of 252.21 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentanoic acid;trifluoromethanesulfonic acid is sourced from PubChem (CID 158887018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).