C10H16 — CID 20744103
1-methyl-2,3-dimethylidenecycloheptane (PubChem CID 20744103) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 1-methyl-2,3-dimethylidenecycloheptane.
| Compound Name | 1-methyl-2,3-dimethylidenecycloheptane |
|---|---|
| PubChem CID | 20744103 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1-methyl-2,3-dimethylidenecycloheptane |
| SMILES | C=C1CCCCC(C)C1=C |
| InChI | InChI=1S/C10H16/c1-8-6-4-5-7-9(2)10(8)3/h9H,1,3-7H2,2H3 |
| InChIKey | BLQSXYRMCQHPET-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |