C10H18O — CID 142053624
2,3-dimethylidenecyclohexan-1-ol;ethane (PubChem CID 142053624) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 2,3-dimethylidenecyclohexan-1-ol;ethane.
| Compound Name | 2,3-dimethylidenecyclohexan-1-ol;ethane |
|---|---|
| PubChem CID | 142053624 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 2,3-dimethylidenecyclohexan-1-ol;ethane |
| SMILES | C=C1CCCC(O)C1=C.CC |
| InChI | InChI=1S/C8H12O.C2H6/c1-6-4-3-5-8(9)7(6)2;1-2/h8-9H,1-5H2;1-2H3 |
| InChIKey | LQPFDLZFEPEGTA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |