C15H29FO — CID 143947837
(1R)-2,3-bis(ethenyl)cyclohex-2-en-1-ol;ethane;fluoromethane (PubChem CID 143947837) has the molecular formula C15H29FO and a molecular weight of 244.39 g/mol. Its IUPAC name is (1R)-2,3-bis(ethenyl)cyclohex-2-en-1-ol;ethane;fluoromethane.
| Compound Name | (1R)-2,3-bis(ethenyl)cyclohex-2-en-1-ol;ethane;fluoromethane |
|---|---|
| PubChem CID | 143947837 |
| Molecular Formula | C15H29FO |
| Molecular Weight | 244.39 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (1R)-2,3-bis(ethenyl)cyclohex-2-en-1-ol;ethane;fluoromethane |
| SMILES | C=CC1=C(C=C)[C@H](O)CCC1.CC.CC.CF |
| InChI | InChI=1S/C10H14O.2C2H6.CH3F/c1-3-8-6-5-7-10(11)9(8)4-2;3*1-2/h3-4,10-11H,1-2,5-7H2;2*1-2H3;1H3/t10-;;;/m1.../s1 |
| InChIKey | GCCDXRQYUGAJHG-FYBBWCNBSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |