C12H18 — CID 157035883
1,2-bis(ethenyl)-3-propan-2-ylcyclopentene (PubChem CID 157035883) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-3-propan-2-ylcyclopentene.
| Compound Name | 1,2-bis(ethenyl)-3-propan-2-ylcyclopentene |
|---|---|
| PubChem CID | 157035883 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 1,2-bis(ethenyl)-3-propan-2-ylcyclopentene |
| SMILES | C=CC1=C(C=C)C(C(C)C)CC1 |
| InChI | InChI=1S/C12H18/c1-5-10-7-8-12(9(3)4)11(10)6-2/h5-6,9,12H,1-2,7-8H2,3-4H3 |
| InChIKey | JUFOJLXSVGEBRX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |