C12H18O — CID 156791141
5,6-bis(ethenyl)-4-propan-2-yl-3,4-dihydro-2H-pyran (PubChem CID 156791141) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-4-propan-2-yl-3,4-dihydro-2H-pyran.
| Compound Name | 5,6-bis(ethenyl)-4-propan-2-yl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 156791141 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 5,6-bis(ethenyl)-4-propan-2-yl-3,4-dihydro-2H-pyran |
| SMILES | C=CC1=C(C=C)C(C(C)C)CCO1 |
| InChI | InChI=1S/C12H18O/c1-5-10-11(9(3)4)7-8-13-12(10)6-2/h5-6,9,11H,1-2,7-8H2,3-4H3 |
| InChIKey | JFAHZRFKGAWIET-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |