C15H26O — CID 145337905
2,3-bis(ethenyl)-6-propan-2-ylcyclohex-2-en-1-ol;ethane (PubChem CID 145337905) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-6-propan-2-ylcyclohex-2-en-1-ol;ethane.
| Compound Name | 2,3-bis(ethenyl)-6-propan-2-ylcyclohex-2-en-1-ol;ethane |
|---|---|
| PubChem CID | 145337905 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 2,3-bis(ethenyl)-6-propan-2-ylcyclohex-2-en-1-ol;ethane |
| SMILES | C=CC1=C(C=C)C(O)C(C(C)C)CC1.CC |
| InChI | InChI=1S/C13H20O.C2H6/c1-5-10-7-8-12(9(3)4)13(14)11(10)6-2;1-2/h5-6,9,12-14H,1-2,7-8H2,3-4H3;1-2H3 |
| InChIKey | HOVUDYXSHBINFY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |