C13H20 — CID 143209894
2-ethenyl-4-methyl-1-(2-methylprop-1-enyl)cyclohexene (PubChem CID 143209894) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 2-ethenyl-4-methyl-1-(2-methylprop-1-enyl)cyclohexene.
| Compound Name | 2-ethenyl-4-methyl-1-(2-methylprop-1-enyl)cyclohexene |
|---|---|
| PubChem CID | 143209894 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 2-ethenyl-4-methyl-1-(2-methylprop-1-enyl)cyclohexene |
| SMILES | C=CC1=C(C=C(C)C)CCC(C)C1 |
| InChI | InChI=1S/C13H20/c1-5-12-9-11(4)6-7-13(12)8-10(2)3/h5,8,11H,1,6-7,9H2,2-4H3 |
| InChIKey | SAUKTTWHRJQSJN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |