C9H12O2 — CID 147376792
4-methylcyclohexene-1,2-dicarbaldehyde (PubChem CID 147376792) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-methylcyclohexene-1,2-dicarbaldehyde.
| Compound Name | 4-methylcyclohexene-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 147376792 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-methylcyclohexene-1,2-dicarbaldehyde |
| SMILES | CC1CCC(C=O)=C(C=O)C1 |
| InChI | InChI=1S/C9H12O2/c1-7-2-3-8(5-10)9(4-7)6-11/h5-7H,2-4H2,1H3 |
| InChIKey | DKEBLLGHXTXBQY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|