About bis(but-2-ene);1-methyl-3-propylidenecyclopentane
bis(but-2-ene);1-methyl-3-propylidenecyclopentane (PubChem CID 173439667) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is bis(but-2-ene);1-methyl-3-propylidenecyclopentane.
Molecular Properties
| Compound Name | bis(but-2-ene);1-methyl-3-propylidenecyclopentane |
| PubChem CID | 173439667 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | bis(but-2-ene);1-methyl-3-propylidenecyclopentane |
| SMILES | CC=CC.CC=CC.CCC=C1CCC(C)C1 |
| InChI | InChI=1S/C9H16.2C4H8/c1-3-4-9-6-5-8(2)7-9;2*1-3-4-2/h4,8H,3,5-7H2,1-2H3;2*3-4H,1-2H3 |
| InChIKey | SHPFAZKLURNRLT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(but-2-ene);1-methyl-3-propylidenecyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(but-2-ene);1-methyl-3-propylidenecyclopentane?
The IUPAC name of bis(but-2-ene);1-methyl-3-propylidenecyclopentane (CID 173439667) is bis(but-2-ene);1-methyl-3-propylidenecyclopentane.
What is the SMILES notation for bis(but-2-ene);1-methyl-3-propylidenecyclopentane?
The canonical SMILES for bis(but-2-ene);1-methyl-3-propylidenecyclopentane is CC=CC.CC=CC.CCC=C1CCC(C)C1.
What is the InChIKey of bis(but-2-ene);1-methyl-3-propylidenecyclopentane?
The InChIKey is SHPFAZKLURNRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16.2C4H8/c1-3-4-9-6-5-8(2)7-9;2*1-3-4-2/h4,8H,3,5-7H2,1-2H3;2*3-4H,1-2H3.
What are the key properties of bis(but-2-ene);1-methyl-3-propylidenecyclopentane?
bis(but-2-ene);1-methyl-3-propylidenecyclopentane has a molecular weight of 236.44 g/mol, XLogP of 6.31, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(but-2-ene);1-methyl-3-propylidenecyclopentane is sourced from PubChem (CID 173439667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).