C13H16O2 — CID 135008237
4-methoxy-7-methyl-5,6,7,8-tetrahydronaphthalene-1-carbaldehyde (PubChem CID 135008237) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-methoxy-7-methyl-5,6,7,8-tetrahydronaphthalene-1-carbaldehyde.
| Compound Name | 4-methoxy-7-methyl-5,6,7,8-tetrahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 135008237 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4-methoxy-7-methyl-5,6,7,8-tetrahydronaphthalene-1-carbaldehyde |
| SMILES | COc1ccc(C=O)c2c1CCC(C)C2 |
| InChI | InChI=1S/C13H16O2/c1-9-3-5-11-12(7-9)10(8-14)4-6-13(11)15-2/h4,6,8-9H,3,5,7H2,1-2H3 |
| InChIKey | QJGBCXIERYSILX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|