C14H20N2O5 — CID 158989698
(5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)urea;formic acid (PubChem CID 158989698) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is (5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)urea;formic acid.
| Compound Name | (5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)urea;formic acid |
|---|---|
| PubChem CID | 158989698 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)urea;formic acid |
| SMILES | COc1ccc(OC)c2c1CCC(NC(N)=O)C2.O=CO |
| InChI | InChI=1S/C13H18N2O3.CH2O2/c1-17-11-5-6-12(18-2)10-7-8(15-13(14)16)3-4-9(10)11;2-1-3/h5-6,8H,3-4,7H2,1-2H3,(H3,14,15,16);1H,(H,2,3) |
| InChIKey | JPZUVXSVDUQHFU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|