C13H15F3N2O4S — CID 76585456
2,2,2-trifluoro-N-(8-methoxy-5-sulfamoyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 76585456) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(8-methoxy-5-sulfamoyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(8-methoxy-5-sulfamoyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 76585456 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2,2,2-trifluoro-N-(8-methoxy-5-sulfamoyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | COc1ccc(S(N)(=O)=O)c2c1CC(NC(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C13H15F3N2O4S/c1-22-10-4-5-11(23(17,20)21)8-3-2-7(6-9(8)10)18-12(19)13(14,15)16/h4-5,7H,2-3,6H2,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | GSCJSCIIWCUTRA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |