C13H12BrF3N2O4 — CID 22082988
N-(6-bromo-5-methoxy-8-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 22082988) has the molecular formula C13H12BrF3N2O4 and a molecular weight of 397.15 g/mol. Its IUPAC name is N-(6-bromo-5-methoxy-8-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(6-bromo-5-methoxy-8-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 22082988 |
| Molecular Formula | C13H12BrF3N2O4 |
| Molecular Weight | 397.15 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | N-(6-bromo-5-methoxy-8-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | COc1c(Br)cc([N+](=O)[O-])c2c1CCC(NC(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C13H12BrF3N2O4/c1-23-11-7-3-2-6(18-12(20)13(15,16)17)4-8(7)10(19(21)22)5-9(11)14/h5-6H,2-4H2,1H3,(H,18,20) |
| InChIKey | ZMYQRKYCBSABQN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|