C13H10F6N2O6S — CID 18690041
[4-nitro-7-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 18690041) has the molecular formula C13H10F6N2O6S and a molecular weight of 436.29 g/mol. Its IUPAC name is [4-nitro-7-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-nitro-7-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 18690041 |
| Molecular Formula | C13H10F6N2O6S |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | [4-nitro-7-[(2,2,2-trifluoroacetyl)amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=C(NC1CCc2c(cc(OS(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])C1)C(F)(F)F |
| InChI | InChI=1S/C13H10F6N2O6S/c14-12(15,16)11(22)20-7-1-2-9-6(3-7)4-8(5-10(9)21(23)24)27-28(25,26)13(17,18)19/h4-5,7H,1-3H2,(H,20,22) |
| InChIKey | AYMOVIJMYIEHMA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|