C12H14F3NO3S — CID 54256947
[7-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 54256947) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is [7-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [7-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54256947 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | [7-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CNC1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-16-10-4-2-8-3-5-11(7-9(8)6-10)19-20(17,18)12(13,14)15/h3,5,7,10,16H,2,4,6H2,1H3 |
| InChIKey | RASSECLLZYIYEG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|