C19H24F3NO5S — CID 87932849
[(1R,13S)-13-[(2-methylpropan-2-yl)oxycarbonylamino]-5-tricyclo[8.2.1.03,8]trideca-3(8),4,6-trienyl] trifluoromethanesulfonate (PubChem CID 87932849) has the molecular formula C19H24F3NO5S and a molecular weight of 435.46 g/mol. Its IUPAC name is [(1R,13S)-13-[(2-methylpropan-2-yl)oxycarbonylamino]-5-tricyclo[8.2.1.03,8]trideca-3(8),4,6-trienyl] trifluoromethanesulfonate.
| Compound Name | [(1R,13S)-13-[(2-methylpropan-2-yl)oxycarbonylamino]-5-tricyclo[8.2.1.03,8]trideca-3(8),4,6-trienyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87932849 |
| Molecular Formula | C19H24F3NO5S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | [(1R,13S)-13-[(2-methylpropan-2-yl)oxycarbonylamino]-5-tricyclo[8.2.1.03,8]trideca-3(8),4,6-trienyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C2CC[C@@H]1Cc1cc(OS(=O)(=O)C(F)(F)F)ccc1C2 |
| InChI | InChI=1S/C19H24F3NO5S/c1-18(2,3)27-17(24)23-16-12-4-5-13(16)9-14-10-15(7-6-11(14)8-12)28-29(25,26)19(20,21)22/h6-7,10,12-13,16H,4-5,8-9H2,1-3H3,(H,23,24)/t12?,13-,16+/m1/s1 |
| InChIKey | STFDMATUFZCQMX-QVNUIZJESA-N |
| XLogP | 3.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|