C21H30F3NO6S — CID 86631097
[8,8-diethyl-6-methoxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]-6,7-dihydro-5H-naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 86631097) has the molecular formula C21H30F3NO6S and a molecular weight of 481.53 g/mol. Its IUPAC name is [8,8-diethyl-6-methoxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]-6,7-dihydro-5H-naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8,8-diethyl-6-methoxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]-6,7-dihydro-5H-naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86631097 |
| Molecular Formula | C21H30F3NO6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [8,8-diethyl-6-methoxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]-6,7-dihydro-5H-naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CCC1(CC)c2cc(OS(=O)(=O)C(F)(F)F)ccc2CC(OC)C1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30F3NO6S/c1-7-20(8-2)15-12-14(31-32(27,28)21(22,23)24)10-9-13(15)11-16(29-6)17(20)25-18(26)30-19(3,4)5/h9-10,12,16-17H,7-8,11H2,1-6H3,(H,25,26) |
| InChIKey | HUOPYWJHMLJTSZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|