C21H21ClF3NO5S — CID 57476723
[8-[(3-chlorophenyl)methyl]-7-(ethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 57476723) has the molecular formula C21H21ClF3NO5S and a molecular weight of 491.92 g/mol. Its IUPAC name is [8-[(3-chlorophenyl)methyl]-7-(ethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-[(3-chlorophenyl)methyl]-7-(ethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57476723 |
| Molecular Formula | C21H21ClF3NO5S |
| Molecular Weight | 491.92 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | [8-[(3-chlorophenyl)methyl]-7-(ethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CCOC(=O)NC1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClF3NO5S/c1-2-30-20(27)26-19-9-7-14-6-8-16(31-32(28,29)21(23,24)25)12-17(14)18(19)11-13-4-3-5-15(22)10-13/h3-6,8,10,12,18-19H,2,7,9,11H2,1H3,(H,26,27) |
| InChIKey | SDSBNETWNSEHLT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.92 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|