C21H28F3NO5S — CID 58123924
tert-butyl 1,13,13-trimethyl-5-(trifluoromethylsulfonyloxy)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carboxylate (PubChem CID 58123924) has the molecular formula C21H28F3NO5S and a molecular weight of 463.52 g/mol. Its IUPAC name is tert-butyl 1,13,13-trimethyl-5-(trifluoromethylsulfonyloxy)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carboxylate.
| Compound Name | tert-butyl 1,13,13-trimethyl-5-(trifluoromethylsulfonyloxy)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carboxylate |
|---|---|
| PubChem CID | 58123924 |
| Molecular Formula | C21H28F3NO5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | tert-butyl 1,13,13-trimethyl-5-(trifluoromethylsulfonyloxy)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C)c3ccc(OS(=O)(=O)C(F)(F)F)cc3CC1C2(C)C |
| InChI | InChI=1S/C21H28F3NO5S/c1-18(2,3)29-17(26)25-10-9-20(6)15-8-7-14(30-31(27,28)21(22,23)24)11-13(15)12-16(25)19(20,4)5/h7-8,11,16H,9-10,12H2,1-6H3 |
| InChIKey | RMZQGZPAECCOKZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|