C23H25ClF3NO5S — CID 57467204
[8-[(4-chlorophenyl)methyl]-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 57467204) has the molecular formula C23H25ClF3NO5S and a molecular weight of 519.97 g/mol. Its IUPAC name is [8-[(4-chlorophenyl)methyl]-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-[(4-chlorophenyl)methyl]-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57467204 |
| Molecular Formula | C23H25ClF3NO5S |
| Molecular Weight | 519.97 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | [8-[(4-chlorophenyl)methyl]-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25ClF3NO5S/c1-22(2,3)32-21(29)28-20-11-7-15-6-10-17(33-34(30,31)23(25,26)27)13-18(15)19(20)12-14-4-8-16(24)9-5-14/h4-6,8-10,13,19-20H,7,11-12H2,1-3H3,(H,28,29) |
| InChIKey | FNLVBNZJVDIQAF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.97 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|