C19H18F3NO5S — CID 86597724
[(7S)-7-(phenylmethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 86597724) has the molecular formula C19H18F3NO5S and a molecular weight of 429.42 g/mol. Its IUPAC name is [(7S)-7-(phenylmethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(7S)-7-(phenylmethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86597724 |
| Molecular Formula | C19H18F3NO5S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | [(7S)-7-(phenylmethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=C(N[C@H]1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1)OCc1ccccc1 |
| InChI | InChI=1S/C19H18F3NO5S/c20-19(21,22)29(25,26)28-17-9-7-14-6-8-16(10-15(14)11-17)23-18(24)27-12-13-4-2-1-3-5-13/h1-5,7,9,11,16H,6,8,10,12H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | BDUGWBJDWIEHOW-INIZCTEOSA-N |
| XLogP | 3.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|