C16H20F3NO5S — CID 59486439
[5-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 59486439) has the molecular formula C16H20F3NO5S and a molecular weight of 395.40 g/mol. Its IUPAC name is [5-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59486439 |
| Molecular Formula | C16H20F3NO5S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1CCCc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H20F3NO5S/c1-15(2,3)24-14(21)20-13-6-4-5-10-9-11(7-8-12(10)13)25-26(22,23)16(17,18)19/h7-9,13H,4-6H2,1-3H3,(H,20,21) |
| InChIKey | LYWGITFZZJANIL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|