C15H21NO4S — CID 154687251
tert-butyl N-(5-methylsulfonyl-2,3-dihydro-1H-inden-2-yl)carbamate (PubChem CID 154687251) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is tert-butyl N-(5-methylsulfonyl-2,3-dihydro-1H-inden-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-methylsulfonyl-2,3-dihydro-1H-inden-2-yl)carbamate |
|---|---|
| PubChem CID | 154687251 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | tert-butyl N-(5-methylsulfonyl-2,3-dihydro-1H-inden-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1Cc2ccc(S(C)(=O)=O)cc2C1 |
| InChI | InChI=1S/C15H21NO4S/c1-15(2,3)20-14(17)16-12-7-10-5-6-13(21(4,18)19)9-11(10)8-12/h5-6,9,12H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | RXFHVYOVQDWFTG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |