C14H19ClN2O2 — CID 162385011
tert-butyl N-(5-amino-4-chloro-2,3-dihydro-1H-inden-2-yl)carbamate (PubChem CID 162385011) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is tert-butyl N-(5-amino-4-chloro-2,3-dihydro-1H-inden-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-amino-4-chloro-2,3-dihydro-1H-inden-2-yl)carbamate |
|---|---|
| PubChem CID | 162385011 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | tert-butyl N-(5-amino-4-chloro-2,3-dihydro-1H-inden-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1Cc2ccc(N)c(Cl)c2C1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-14(2,3)19-13(18)17-9-6-8-4-5-11(16)12(15)10(8)7-9/h4-5,9H,6-7,16H2,1-3H3,(H,17,18) |
| InChIKey | YZGURMDATPMXLU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|