C22H35ClN2O5Si — CID 156862428
2-trimethylsilylethyl N-[4-chloro-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-2,3-dihydro-1H-inden-2-yl]carbamate (PubChem CID 156862428) has the molecular formula C22H35ClN2O5Si and a molecular weight of 471.07 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[4-chloro-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-2,3-dihydro-1H-inden-2-yl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[4-chloro-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-2,3-dihydro-1H-inden-2-yl]carbamate |
|---|---|
| PubChem CID | 156862428 |
| Molecular Formula | C22H35ClN2O5Si |
| Molecular Weight | 471.07 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-trimethylsilylethyl N-[4-chloro-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]-2,3-dihydro-1H-inden-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc2c(c1Cl)CC(NC(=O)OCC[Si](C)(C)C)C2 |
| InChI | InChI=1S/C22H35ClN2O5Si/c1-22(2,3)30-20(26)24-9-10-28-18-8-7-15-13-16(14-17(15)19(18)23)25-21(27)29-11-12-31(4,5)6/h7-8,16H,9-14H2,1-6H3,(H,24,26)(H,25,27) |
| InChIKey | SUCARWPONCUODR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.07 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|