C19H27ClN2O5 — CID 150866994
tert-butyl N-[(3R,6S)-6-[2-(4-chlorophenoxy)ethylcarbamoyl]oxan-3-yl]carbamate (PubChem CID 150866994) has the molecular formula C19H27ClN2O5 and a molecular weight of 398.89 g/mol. Its IUPAC name is tert-butyl N-[(3R,6S)-6-[2-(4-chlorophenoxy)ethylcarbamoyl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,6S)-6-[2-(4-chlorophenoxy)ethylcarbamoyl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 150866994 |
| Molecular Formula | C19H27ClN2O5 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | tert-butyl N-[(3R,6S)-6-[2-(4-chlorophenoxy)ethylcarbamoyl]oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](C(=O)NCCOc2ccc(Cl)cc2)OC1 |
| InChI | InChI=1S/C19H27ClN2O5/c1-19(2,3)27-18(24)22-14-6-9-16(26-12-14)17(23)21-10-11-25-15-7-4-13(20)5-8-15/h4-5,7-8,14,16H,6,9-12H2,1-3H3,(H,21,23)(H,22,24)/t14-,16+/m1/s1 |
| InChIKey | KTGKCGCVQCTZBM-ZBFHGGJFSA-N |
| XLogP | 2.91 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|