C23H40N2O4Si — CID 164539784
tert-butyl N-[4-[2-(2-trimethylsilylethoxymethoxy)anilino]cyclohexyl]carbamate (PubChem CID 164539784) has the molecular formula C23H40N2O4Si and a molecular weight of 436.67 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(2-trimethylsilylethoxymethoxy)anilino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(2-trimethylsilylethoxymethoxy)anilino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 164539784 |
| Molecular Formula | C23H40N2O4Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | tert-butyl N-[4-[2-(2-trimethylsilylethoxymethoxy)anilino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2ccccc2OCOCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C23H40N2O4Si/c1-23(2,3)29-22(26)25-19-13-11-18(12-14-19)24-20-9-7-8-10-21(20)28-17-27-15-16-30(4,5)6/h7-10,18-19,24H,11-17H2,1-6H3,(H,25,26) |
| InChIKey | XTZZRGYWEVJTLP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|