C21H26F3N3O2 — CID 163267387
tert-butyl N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]carbamate (PubChem CID 163267387) has the molecular formula C21H26F3N3O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 163267387 |
| Molecular Formula | C21H26F3N3O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | tert-butyl N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2cc(C(F)(F)F)nc3ccccc23)CC1 |
| InChI | InChI=1S/C21H26F3N3O2/c1-20(2,3)29-19(28)26-14-10-8-13(9-11-14)25-17-12-18(21(22,23)24)27-16-7-5-4-6-15(16)17/h4-7,12-14H,8-11H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | GQIZFTRDCTUYIF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |