C27H28FN3O2 — CID 167099214
N-[4-[[2-(2-fluoropropan-2-yl)quinolin-4-yl]amino]cyclohexyl]-1-benzofuran-3-carboxamide (PubChem CID 167099214) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[4-[[2-(2-fluoropropan-2-yl)quinolin-4-yl]amino]cyclohexyl]-1-benzofuran-3-carboxamide.
| Compound Name | N-[4-[[2-(2-fluoropropan-2-yl)quinolin-4-yl]amino]cyclohexyl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 167099214 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-[4-[[2-(2-fluoropropan-2-yl)quinolin-4-yl]amino]cyclohexyl]-1-benzofuran-3-carboxamide |
| SMILES | CC(C)(F)c1cc(NC2CCC(NC(=O)c3coc4ccccc34)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C27H28FN3O2/c1-27(2,28)25-15-23(20-8-3-5-9-22(20)31-25)29-17-11-13-18(14-12-17)30-26(32)21-16-33-24-10-6-4-7-19(21)24/h3-10,15-18H,11-14H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | LKDBSRCYLRPDRI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |