C24H23F4N3O — CID 163267200
2-fluoro-6-methyl-N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide (PubChem CID 163267200) has the molecular formula C24H23F4N3O and a molecular weight of 445.46 g/mol. Its IUPAC name is 2-fluoro-6-methyl-N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide.
| Compound Name | 2-fluoro-6-methyl-N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 163267200 |
| Molecular Formula | C24H23F4N3O |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 2-fluoro-6-methyl-N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide |
| SMILES | Cc1cccc(F)c1C(=O)NC1CCC(Nc2cc(C(F)(F)F)nc3ccccc23)CC1 |
| InChI | InChI=1S/C24H23F4N3O/c1-14-5-4-7-18(25)22(14)23(32)30-16-11-9-15(10-12-16)29-20-13-21(24(26,27)28)31-19-8-3-2-6-17(19)20/h2-8,13,15-16H,9-12H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | IJQLRDHWZABTMM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |