C23H21ClF3N3O — CID 163267255
2-chloro-N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide (PubChem CID 163267255) has the molecular formula C23H21ClF3N3O and a molecular weight of 447.89 g/mol. Its IUPAC name is 2-chloro-N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide.
| Compound Name | 2-chloro-N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 163267255 |
| Molecular Formula | C23H21ClF3N3O |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-chloro-N-[4-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(Nc2cc(C(F)(F)F)nc3ccccc23)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C23H21ClF3N3O/c24-18-7-3-1-5-16(18)22(31)29-15-11-9-14(10-12-15)28-20-13-21(23(25,26)27)30-19-8-4-2-6-17(19)20/h1-8,13-15H,9-12H2,(H,28,30)(H,29,31) |
| InChIKey | MAGNYVSOKVENPL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |