C22H22F3N3OSSi — CID 163266902
CID 163266902 (PubChem CID 163266902) has the molecular formula C22H22F3N3OSSi and a molecular weight of 461.59 g/mol.
| Compound Name | CID 163266902 |
|---|---|
| PubChem CID | 163266902 |
| Molecular Formula | C22H22F3N3OSSi |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | — |
| SMILES | Cc1ccsc1C(=O)N[C@H]1CC[C@@H](Nc2cc(C(F)(F)F)nc3ccccc23)CC[Si]1 |
| InChI | InChI=1S/C22H22F3N3OSSi/c1-13-8-10-30-20(13)21(29)28-19-7-6-14(9-11-31-19)26-17-12-18(22(23,24)25)27-16-5-3-2-4-15(16)17/h2-5,8,10,12,14,19H,6-7,9,11H2,1H3,(H,26,27)(H,28,29)/t14-,19-/m1/s1 |
| InChIKey | REHROPREZGMZDN-AUUYWEPGSA-N |
| XLogP | 5.47 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|