About CID 163266902
CID 163266902 (PubChem CID 163266902) has the molecular formula C22H22F3N3OSSi
and a molecular weight of 461.59 g/mol.
Molecular Properties
| Compound Name | CID 163266902 |
| PubChem CID | 163266902 |
| Molecular Formula | C22H22F3N3OSSi |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | — |
| SMILES | Cc1ccsc1C(=O)N[C@H]1CC[C@@H](Nc2cc(C(F)(F)F)nc3ccccc23)CC[Si]1 |
| InChI | InChI=1S/C22H22F3N3OSSi/c1-13-8-10-30-20(13)21(29)28-19-7-6-14(9-11-31-19)26-17-12-18(22(23,24)25)27-16-5-3-2-4-15(16)17/h2-5,8,10,12,14,19H,6-7,9,11H2,1H3,(H,26,27)(H,28,29)/t14-,19-/m1/s1 |
| InChIKey | REHROPREZGMZDN-AUUYWEPGSA-N |
| XLogP | 5.47 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163266902 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163266902?
The IUPAC name of CID 163266902 (CID 163266902) is not available.
What is the SMILES notation for CID 163266902?
The canonical SMILES for CID 163266902 is Cc1ccsc1C(=O)N[C@H]1CC[C@@H](Nc2cc(C(F)(F)F)nc3ccccc23)CC[Si]1.
What is the InChIKey of CID 163266902?
The InChIKey is REHROPREZGMZDN-AUUYWEPGSA-N. The full InChI is InChI=1S/C22H22F3N3OSSi/c1-13-8-10-30-20(13)21(29)28-19-7-6-14(9-11-31-19)26-17-12-18(22(23,24)25)27-16-5-3-2-4-15(16)17/h2-5,8,10,12,14,19H,6-7,9,11H2,1H3,(H,26,27)(H,28,29)/t14-,19-/m1/s1.
What are the key properties of CID 163266902?
CID 163266902 has a molecular weight of 461.59 g/mol, XLogP of 5.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163266902 is sourced from PubChem (CID 163266902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).