C15H17ClF3NO5S — CID 162383913
[6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-inden-4-yl] trifluoromethanesulfonate (PubChem CID 162383913) has the molecular formula C15H17ClF3NO5S and a molecular weight of 415.82 g/mol. Its IUPAC name is [6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-inden-4-yl] trifluoromethanesulfonate.
| Compound Name | [6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-inden-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162383913 |
| Molecular Formula | C15H17ClF3NO5S |
| Molecular Weight | 415.82 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [6-chloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-inden-4-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1Cc2cc(Cl)cc(OS(=O)(=O)C(F)(F)F)c2C1 |
| InChI | InChI=1S/C15H17ClF3NO5S/c1-14(2,3)24-13(21)20-10-5-8-4-9(16)6-12(11(8)7-10)25-26(22,23)15(17,18)19/h4,6,10H,5,7H2,1-3H3,(H,20,21) |
| InChIKey | BHUUDTMNWYDFDD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.82 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|