C15H16F3NO7S — CID 10319423
3-O-ethyl 2-O-methyl 6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 10319423) has the molecular formula C15H16F3NO7S and a molecular weight of 411.35 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl 6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl 6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10319423 |
| Molecular Formula | C15H16F3NO7S |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 3-O-ethyl 2-O-methyl 6-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1Cc2cc(OS(=O)(=O)C(F)(F)F)ccc2CN1C(=O)OC |
| InChI | InChI=1S/C15H16F3NO7S/c1-3-25-13(20)12-7-10-6-11(26-27(22,23)15(16,17)18)5-4-9(10)8-19(12)14(21)24-2/h4-6,12H,3,7-8H2,1-2H3 |
| InChIKey | PCLDSSOWBHCBLS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|