C16H21NO4 — CID 57203626
N-[5,8-dimethoxy-1-(2-oxoethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide (PubChem CID 57203626) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[5,8-dimethoxy-1-(2-oxoethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide.
| Compound Name | N-[5,8-dimethoxy-1-(2-oxoethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 57203626 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[5,8-dimethoxy-1-(2-oxoethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide |
| SMILES | COc1ccc(OC)c2c1CCC(NC(C)=O)C2CC=O |
| InChI | InChI=1S/C16H21NO4/c1-10(19)17-13-5-4-12-14(20-2)6-7-15(21-3)16(12)11(13)8-9-18/h6-7,9,11,13H,4-5,8H2,1-3H3,(H,17,19) |
| InChIKey | QTCMDFCCKMYAIJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|