C10H14O — CID 143180864
3-ethenyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-ol (PubChem CID 143180864) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-ethenyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-ol.
| Compound Name | 3-ethenyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 143180864 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3-ethenyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-ol |
| SMILES | C=CC1=C(/C=C\C)CC(O)C1 |
| InChI | InChI=1S/C10H14O/c1-3-5-9-7-10(11)6-8(9)4-2/h3-5,10-11H,2,6-7H2,1H3/b5-3- |
| InChIKey | PWAGPQBQKPAOHD-HYXAFXHYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |