C12H18 — CID 145347236
(3R)-2-ethenyl-3-methyl-1-[(Z)-prop-1-enyl]cyclohexene (PubChem CID 145347236) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (3R)-2-ethenyl-3-methyl-1-[(Z)-prop-1-enyl]cyclohexene.
| Compound Name | (3R)-2-ethenyl-3-methyl-1-[(Z)-prop-1-enyl]cyclohexene |
|---|---|
| PubChem CID | 145347236 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (3R)-2-ethenyl-3-methyl-1-[(Z)-prop-1-enyl]cyclohexene |
| SMILES | C=CC1=C(/C=C\C)CCC[C@H]1C |
| InChI | InChI=1S/C12H18/c1-4-7-11-9-6-8-10(3)12(11)5-2/h4-5,7,10H,2,6,8-9H2,1,3H3/b7-4-/t10-/m1/s1 |
| InChIKey | LOBJEFLOTNNKDA-ISGFRBBESA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |