C13H19N — CID 143343575
(1S)-2-[(1Z)-buta-1,3-dienyl]-N-methyl-3-[(Z)-prop-1-enyl]cyclopent-2-en-1-amine (PubChem CID 143343575) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (1S)-2-[(1Z)-buta-1,3-dienyl]-N-methyl-3-[(Z)-prop-1-enyl]cyclopent-2-en-1-amine.
| Compound Name | (1S)-2-[(1Z)-buta-1,3-dienyl]-N-methyl-3-[(Z)-prop-1-enyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 143343575 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1S)-2-[(1Z)-buta-1,3-dienyl]-N-methyl-3-[(Z)-prop-1-enyl]cyclopent-2-en-1-amine |
| SMILES | C=C/C=C\C1=C(/C=C\C)CC[C@@H]1NC |
| InChI | InChI=1S/C13H19N/c1-4-6-8-12-11(7-5-2)9-10-13(12)14-3/h4-8,13-14H,1,9-10H2,2-3H3/b7-5-,8-6-/t13-/m0/s1 |
| InChIKey | ULKFCGFKLYBHOW-XNSWAYSTSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|