C14H18O — CID 167170644
3-[(1Z)-buta-1,3-dienyl]-2-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one (PubChem CID 167170644) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one |
|---|---|
| PubChem CID | 167170644 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-methyl-3a,4,5,6,7,7a-hexahydroinden-1-one |
| SMILES | C=C/C=C\C1=C(C)C(=O)C2CCCCC12 |
| InChI | InChI=1S/C14H18O/c1-3-4-7-11-10(2)14(15)13-9-6-5-8-12(11)13/h3-4,7,12-13H,1,5-6,8-9H2,2H3/b7-4- |
| InChIKey | YJJGPVFUKLEMJL-DAXSKMNVSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|